N-[(4-fluorophenyl)methyl]-6-(4-methoxyphenyl)-1,1-dioxo-2,3-dihydro-1H-1lambda~6~-imidazo[2,1-b][1,3]thiazole-5-carboxamide
Chemical Structure Depiction of
N-[(4-fluorophenyl)methyl]-6-(4-methoxyphenyl)-1,1-dioxo-2,3-dihydro-1H-1lambda~6~-imidazo[2,1-b][1,3]thiazole-5-carboxamide
N-[(4-fluorophenyl)methyl]-6-(4-methoxyphenyl)-1,1-dioxo-2,3-dihydro-1H-1lambda~6~-imidazo[2,1-b][1,3]thiazole-5-carboxamide
Compound characteristics
| Compound ID: | D455-0919 |
| Compound Name: | N-[(4-fluorophenyl)methyl]-6-(4-methoxyphenyl)-1,1-dioxo-2,3-dihydro-1H-1lambda~6~-imidazo[2,1-b][1,3]thiazole-5-carboxamide |
| Molecular Weight: | 415.44 |
| Molecular Formula: | C20 H18 F N3 O4 S |
| Smiles: | COc1ccc(cc1)c1c(C(NCc2ccc(cc2)F)=O)n2CCS(c2n1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.2899 |
| logD: | 2.2898 |
| logSw: | -2.7611 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 73.473 |
| InChI Key: | GRXDQABZPUCQLI-UHFFFAOYSA-N |