N-(4-chlorophenyl)-6-(4-methoxyphenyl)-1,1-dioxo-2,3-dihydro-1H-1lambda~6~-imidazo[2,1-b][1,3]thiazole-5-carboxamide
Chemical Structure Depiction of
N-(4-chlorophenyl)-6-(4-methoxyphenyl)-1,1-dioxo-2,3-dihydro-1H-1lambda~6~-imidazo[2,1-b][1,3]thiazole-5-carboxamide
N-(4-chlorophenyl)-6-(4-methoxyphenyl)-1,1-dioxo-2,3-dihydro-1H-1lambda~6~-imidazo[2,1-b][1,3]thiazole-5-carboxamide
Compound characteristics
| Compound ID: | D455-0929 |
| Compound Name: | N-(4-chlorophenyl)-6-(4-methoxyphenyl)-1,1-dioxo-2,3-dihydro-1H-1lambda~6~-imidazo[2,1-b][1,3]thiazole-5-carboxamide |
| Molecular Weight: | 417.87 |
| Molecular Formula: | C19 H16 Cl N3 O4 S |
| Smiles: | COc1ccc(cc1)c1c(C(Nc2ccc(cc2)[Cl])=O)n2CCS(c2n1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2642 |
| logD: | 3.2596 |
| logSw: | -3.9696 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 72.151 |
| InChI Key: | CWDNKIFOVUKLLN-UHFFFAOYSA-N |