4-({[(4-ethoxyphenyl)methyl](ethyl)amino}methyl)-6-methoxy-2H-1-benzopyran-2-one
Chemical Structure Depiction of
4-({[(4-ethoxyphenyl)methyl](ethyl)amino}methyl)-6-methoxy-2H-1-benzopyran-2-one
4-({[(4-ethoxyphenyl)methyl](ethyl)amino}methyl)-6-methoxy-2H-1-benzopyran-2-one
Compound characteristics
| Compound ID: | D456-0494 |
| Compound Name: | 4-({[(4-ethoxyphenyl)methyl](ethyl)amino}methyl)-6-methoxy-2H-1-benzopyran-2-one |
| Molecular Weight: | 367.44 |
| Molecular Formula: | C22 H25 N O4 |
| Smiles: | CCN(CC1=CC(=O)Oc2ccc(cc12)OC)Cc1ccc(cc1)OCC |
| Stereo: | ACHIRAL |
| logP: | 3.7871 |
| logD: | 3.7466 |
| logSw: | -3.9688 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 38.75 |
| InChI Key: | WNNHVAAHBGQWNW-UHFFFAOYSA-N |