4-({[(4-fluorophenyl)methyl](2-methoxyethyl)amino}methyl)-6,8-dimethyl-2H-1-benzopyran-2-one
					Chemical Structure Depiction of
4-({[(4-fluorophenyl)methyl](2-methoxyethyl)amino}methyl)-6,8-dimethyl-2H-1-benzopyran-2-one
			4-({[(4-fluorophenyl)methyl](2-methoxyethyl)amino}methyl)-6,8-dimethyl-2H-1-benzopyran-2-one
Compound characteristics
| Compound ID: | D456-0665 | 
| Compound Name: | 4-({[(4-fluorophenyl)methyl](2-methoxyethyl)amino}methyl)-6,8-dimethyl-2H-1-benzopyran-2-one | 
| Molecular Weight: | 369.43 | 
| Molecular Formula: | C22 H24 F N O3 | 
| Smiles: | Cc1cc(C)c2c(c1)C(CN(CCOC)Cc1ccc(cc1)F)=CC(=O)O2 | 
| Stereo: | ACHIRAL | 
| logP: | 4.0254 | 
| logD: | 3.8887 | 
| logSw: | -4.1407 | 
| Hydrogen bond acceptors count: | 5 | 
| Polar surface area: | 32.362 | 
| InChI Key: | GCAUALXCADGEHI-UHFFFAOYSA-N | 
 
				 
				