2-fluoro-N-[3-(3-methoxy-4-propoxyphenyl)-1,2,4-thiadiazol-5-yl]benzamide
Chemical Structure Depiction of
2-fluoro-N-[3-(3-methoxy-4-propoxyphenyl)-1,2,4-thiadiazol-5-yl]benzamide
2-fluoro-N-[3-(3-methoxy-4-propoxyphenyl)-1,2,4-thiadiazol-5-yl]benzamide
Compound characteristics
| Compound ID: | D457-0398 |
| Compound Name: | 2-fluoro-N-[3-(3-methoxy-4-propoxyphenyl)-1,2,4-thiadiazol-5-yl]benzamide |
| Molecular Weight: | 387.43 |
| Molecular Formula: | C19 H18 F N3 O3 S |
| Smiles: | [H]N(C(c1ccccc1F)=O)c1nc(c2ccc(c(c2)OC)OCCC)ns1 |
| Stereo: | ACHIRAL |
| logP: | 4.6588 |
| logD: | 4.6147 |
| logSw: | -4.5018 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.052 |
| InChI Key: | LAGUNLKVEZOUJT-UHFFFAOYSA-N |