N-[(4-chlorophenyl)(pyridin-3-yl)methyl]furan-2-carboxamide
Chemical Structure Depiction of
N-[(4-chlorophenyl)(pyridin-3-yl)methyl]furan-2-carboxamide
N-[(4-chlorophenyl)(pyridin-3-yl)methyl]furan-2-carboxamide
Compound characteristics
| Compound ID: | D462-0962 |
| Compound Name: | N-[(4-chlorophenyl)(pyridin-3-yl)methyl]furan-2-carboxamide |
| Molecular Weight: | 312.75 |
| Molecular Formula: | C17 H13 Cl N2 O2 |
| Smiles: | c1cc(cnc1)C(c1ccc(cc1)[Cl])NC(c1ccco1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.9684 |
| logD: | 2.9679 |
| logSw: | -3.7513 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.828 |
| InChI Key: | RQMOKZYQNUXZQE-INIZCTEOSA-N |