N-cyclopentyl-3-(4-fluorophenyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-amine
Chemical Structure Depiction of
N-cyclopentyl-3-(4-fluorophenyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-amine
N-cyclopentyl-3-(4-fluorophenyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-amine
Compound characteristics
| Compound ID: | D463-0038 |
| Compound Name: | N-cyclopentyl-3-(4-fluorophenyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-amine |
| Molecular Weight: | 324.4 |
| Molecular Formula: | C19 H21 F N4 |
| Smiles: | Cc1cc(NC2CCCC2)n2c(c(c3ccc(cc3)F)c(C)n2)n1 |
| Stereo: | ACHIRAL |
| logP: | 4.1786 |
| logD: | 3.3024 |
| logSw: | -4.3958 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 30.9934 |
| InChI Key: | INDNKTRXQUYXNL-UHFFFAOYSA-N |