2-[2-methyl-4-(thiophen-2-yl)-1,3-thiazol-5-yl]-N-[(pyridin-4-yl)methyl]acetamide
Chemical Structure Depiction of
2-[2-methyl-4-(thiophen-2-yl)-1,3-thiazol-5-yl]-N-[(pyridin-4-yl)methyl]acetamide
2-[2-methyl-4-(thiophen-2-yl)-1,3-thiazol-5-yl]-N-[(pyridin-4-yl)methyl]acetamide
Compound characteristics
| Compound ID: | D464-0044 |
| Compound Name: | 2-[2-methyl-4-(thiophen-2-yl)-1,3-thiazol-5-yl]-N-[(pyridin-4-yl)methyl]acetamide |
| Molecular Weight: | 329.44 |
| Molecular Formula: | C16 H15 N3 O S2 |
| Smiles: | Cc1nc(c2cccs2)c(CC(NCc2ccncc2)=O)s1 |
| Stereo: | ACHIRAL |
| logP: | 2.5154 |
| logD: | 2.512 |
| logSw: | -2.4862 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.196 |
| InChI Key: | WGVOHMKPECBRMV-UHFFFAOYSA-N |