N-(3,5-dimethylphenyl)-2-[2-methyl-4-(thiophen-2-yl)-1,3-thiazol-5-yl]acetamide
Chemical Structure Depiction of
N-(3,5-dimethylphenyl)-2-[2-methyl-4-(thiophen-2-yl)-1,3-thiazol-5-yl]acetamide
N-(3,5-dimethylphenyl)-2-[2-methyl-4-(thiophen-2-yl)-1,3-thiazol-5-yl]acetamide
Compound characteristics
| Compound ID: | D464-0130 |
| Compound Name: | N-(3,5-dimethylphenyl)-2-[2-methyl-4-(thiophen-2-yl)-1,3-thiazol-5-yl]acetamide |
| Molecular Weight: | 342.48 |
| Molecular Formula: | C18 H18 N2 O S2 |
| Smiles: | Cc1cc(C)cc(c1)NC(Cc1c(c2cccs2)nc(C)s1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9025 |
| logD: | 4.9025 |
| logSw: | -4.6374 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 34.445 |
| InChI Key: | AFSUKGOKQIEWKC-UHFFFAOYSA-N |