N-(4-chlorophenyl)-2-[2-methyl-4-(thiophen-2-yl)-1,3-thiazol-5-yl]acetamide
Chemical Structure Depiction of
N-(4-chlorophenyl)-2-[2-methyl-4-(thiophen-2-yl)-1,3-thiazol-5-yl]acetamide
N-(4-chlorophenyl)-2-[2-methyl-4-(thiophen-2-yl)-1,3-thiazol-5-yl]acetamide
Compound characteristics
| Compound ID: | D464-0149 |
| Compound Name: | N-(4-chlorophenyl)-2-[2-methyl-4-(thiophen-2-yl)-1,3-thiazol-5-yl]acetamide |
| Molecular Weight: | 348.87 |
| Molecular Formula: | C16 H13 Cl N2 O S2 |
| Smiles: | Cc1nc(c2cccs2)c(CC(Nc2ccc(cc2)[Cl])=O)s1 |
| Stereo: | ACHIRAL |
| logP: | 4.8043 |
| logD: | 4.8041 |
| logSw: | -4.8488 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 34.445 |
| InChI Key: | ZEKNNNPXLSJOJS-UHFFFAOYSA-N |