5-[4-(4-methoxybenzoyl)piperazin-1-yl]-2-[2-(4-methoxyphenyl)ethenyl]-1,3-oxazole-4-carbonitrile
Chemical Structure Depiction of
5-[4-(4-methoxybenzoyl)piperazin-1-yl]-2-[2-(4-methoxyphenyl)ethenyl]-1,3-oxazole-4-carbonitrile
5-[4-(4-methoxybenzoyl)piperazin-1-yl]-2-[2-(4-methoxyphenyl)ethenyl]-1,3-oxazole-4-carbonitrile
Compound characteristics
| Compound ID: | D465-0113 |
| Compound Name: | 5-[4-(4-methoxybenzoyl)piperazin-1-yl]-2-[2-(4-methoxyphenyl)ethenyl]-1,3-oxazole-4-carbonitrile |
| Molecular Weight: | 444.49 |
| Molecular Formula: | C25 H24 N4 O4 |
| Smiles: | COc1ccc(/C=C/c2nc(C#N)c(N3CCN(CC3)C(c3ccc(cc3)OC)=O)o2)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.7509 |
| logD: | 3.7509 |
| logSw: | -4.1034 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 70.964 |
| InChI Key: | YPCCAFFCMHJILL-UHFFFAOYSA-N |