2-ethoxy-N-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]benzamide
					Chemical Structure Depiction of
2-ethoxy-N-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]benzamide
			2-ethoxy-N-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]benzamide
Compound characteristics
| Compound ID: | D468-0165 | 
| Compound Name: | 2-ethoxy-N-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]benzamide | 
| Molecular Weight: | 323.35 | 
| Molecular Formula: | C18 H17 N3 O3 | 
| Smiles: | [H]N(C(c1ccccc1OCC)=O)c1nc(c2ccc(C)cc2)on1 | 
| Stereo: | ACHIRAL | 
| logP: | 4.0558 | 
| logD: | 3.8907 | 
| logSw: | -4.1624 | 
| Hydrogen bond acceptors count: | 6 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 63.351 | 
| InChI Key: | CBYACPGYMOOFQH-UHFFFAOYSA-N | 
 
				 
				