4-(ethylsulfanyl)-1-[(furan-2-yl)methyl]-1,5,6,7-tetrahydro-2H-cyclopenta[d]pyrimidin-2-one
Chemical Structure Depiction of
4-(ethylsulfanyl)-1-[(furan-2-yl)methyl]-1,5,6,7-tetrahydro-2H-cyclopenta[d]pyrimidin-2-one
4-(ethylsulfanyl)-1-[(furan-2-yl)methyl]-1,5,6,7-tetrahydro-2H-cyclopenta[d]pyrimidin-2-one
Compound characteristics
| Compound ID: | D468-0732 |
| Compound Name: | 4-(ethylsulfanyl)-1-[(furan-2-yl)methyl]-1,5,6,7-tetrahydro-2H-cyclopenta[d]pyrimidin-2-one |
| Molecular Weight: | 276.35 |
| Molecular Formula: | C14 H16 N2 O2 S |
| Smiles: | [H]C([H])(C)SC1C2CCCC=2N(Cc2ccco2)C(N=1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.6341 |
| logD: | 2.6341 |
| logSw: | -2.6848 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 32.506 |
| InChI Key: | PPLMNMMUGDJOAR-UHFFFAOYSA-N |