2-methoxy-N-(4-methoxyphenyl)-5-(1,1,3-trioxo-1lambda~6~,2-thiazolidin-2-yl)benzene-1-sulfonamide
Chemical Structure Depiction of
2-methoxy-N-(4-methoxyphenyl)-5-(1,1,3-trioxo-1lambda~6~,2-thiazolidin-2-yl)benzene-1-sulfonamide
2-methoxy-N-(4-methoxyphenyl)-5-(1,1,3-trioxo-1lambda~6~,2-thiazolidin-2-yl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | D470-0276 |
| Compound Name: | 2-methoxy-N-(4-methoxyphenyl)-5-(1,1,3-trioxo-1lambda~6~,2-thiazolidin-2-yl)benzene-1-sulfonamide |
| Molecular Weight: | 426.47 |
| Molecular Formula: | C17 H18 N2 O7 S2 |
| Smiles: | COc1ccc(cc1)NS(c1cc(ccc1OC)N1C(CCS1(=O)=O)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.1658 |
| logD: | 1.1156 |
| logSw: | -2.4951 |
| Hydrogen bond acceptors count: | 12 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 101.479 |
| InChI Key: | OWMQFYDOIUQLDG-UHFFFAOYSA-N |