rel-(3R,4S)-3-[(2,2-dimethoxyethyl)amino]-4-(4-methylbenzene-1-sulfonyl)-1lambda~6~-thiolane-1,1-dione
Chemical Structure Depiction of
rel-(3R,4S)-3-[(2,2-dimethoxyethyl)amino]-4-(4-methylbenzene-1-sulfonyl)-1lambda~6~-thiolane-1,1-dione
rel-(3R,4S)-3-[(2,2-dimethoxyethyl)amino]-4-(4-methylbenzene-1-sulfonyl)-1lambda~6~-thiolane-1,1-dione
Compound characteristics
| Compound ID: | D470-1883 |
| Compound Name: | rel-(3R,4S)-3-[(2,2-dimethoxyethyl)amino]-4-(4-methylbenzene-1-sulfonyl)-1lambda~6~-thiolane-1,1-dione |
| Molecular Weight: | 377.48 |
| Molecular Formula: | C15 H23 N O6 S2 |
| Smiles: | Cc1ccc(cc1)S([C@H]1CS(C[C@@H]1NCC(OC)OC)(=O)=O)(=O)=O |
| Stereo: | RACEMIC MIXTURE (RELATIVE) |
| logP: | -0.2476 |
| logD: | -0.2476 |
| logSw: | -1.8829 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 85.614 |
| InChI Key: | JCWVRPKJCGEBLR-ZIAGYGMSSA-N |