rel-(3R,4S)-3-(4-ethoxybenzene-1-sulfonyl)-4-{[(furan-2-yl)methyl]amino}-1lambda~6~-thiolane-1,1-dione
Chemical Structure Depiction of
rel-(3R,4S)-3-(4-ethoxybenzene-1-sulfonyl)-4-{[(furan-2-yl)methyl]amino}-1lambda~6~-thiolane-1,1-dione
rel-(3R,4S)-3-(4-ethoxybenzene-1-sulfonyl)-4-{[(furan-2-yl)methyl]amino}-1lambda~6~-thiolane-1,1-dione
Compound characteristics
| Compound ID: | D470-2278 |
| Compound Name: | rel-(3R,4S)-3-(4-ethoxybenzene-1-sulfonyl)-4-{[(furan-2-yl)methyl]amino}-1lambda~6~-thiolane-1,1-dione |
| Molecular Weight: | 399.48 |
| Molecular Formula: | C17 H21 N O6 S2 |
| Smiles: | CCOc1ccc(cc1)S([C@H]1CS(C[C@@H]1NCc1ccco1)(=O)=O)(=O)=O |
| Stereo: | RACEMIC MIXTURE (RELATIVE) |
| logP: | 1.0042 |
| logD: | 1.0042 |
| logSw: | -2.0846 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 84.721 |
| InChI Key: | BFUNIYVFOGMSIY-IAGOWNOFSA-N |