7-(4-methoxyphenyl)-8,9-dimethyl-2-(thiophen-2-yl)-7H-pyrrolo[3,2-e][1,2,4]triazolo[1,5-c]pyrimidine
Chemical Structure Depiction of
7-(4-methoxyphenyl)-8,9-dimethyl-2-(thiophen-2-yl)-7H-pyrrolo[3,2-e][1,2,4]triazolo[1,5-c]pyrimidine
7-(4-methoxyphenyl)-8,9-dimethyl-2-(thiophen-2-yl)-7H-pyrrolo[3,2-e][1,2,4]triazolo[1,5-c]pyrimidine
Compound characteristics
| Compound ID: | D472-0294 |
| Compound Name: | 7-(4-methoxyphenyl)-8,9-dimethyl-2-(thiophen-2-yl)-7H-pyrrolo[3,2-e][1,2,4]triazolo[1,5-c]pyrimidine |
| Molecular Weight: | 375.45 |
| Molecular Formula: | C20 H17 N5 O S |
| Smiles: | Cc1c2c(ncn3c2nc(c2cccs2)n3)n(c2ccc(cc2)OC)c1C |
| Stereo: | ACHIRAL |
| logP: | 4.1577 |
| logD: | 4.0683 |
| logSw: | -4.5345 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 41.38 |
| InChI Key: | LBKXVUCVVTXDKR-UHFFFAOYSA-N |