2-(2-chlorophenyl)-7-(4-ethoxyphenyl)-8,9-dimethyl-7H-pyrrolo[3,2-e][1,2,4]triazolo[1,5-c]pyrimidine
Chemical Structure Depiction of
2-(2-chlorophenyl)-7-(4-ethoxyphenyl)-8,9-dimethyl-7H-pyrrolo[3,2-e][1,2,4]triazolo[1,5-c]pyrimidine
2-(2-chlorophenyl)-7-(4-ethoxyphenyl)-8,9-dimethyl-7H-pyrrolo[3,2-e][1,2,4]triazolo[1,5-c]pyrimidine
Compound characteristics
| Compound ID: | D472-0313 |
| Compound Name: | 2-(2-chlorophenyl)-7-(4-ethoxyphenyl)-8,9-dimethyl-7H-pyrrolo[3,2-e][1,2,4]triazolo[1,5-c]pyrimidine |
| Molecular Weight: | 417.9 |
| Molecular Formula: | C23 H20 Cl N5 O |
| Smiles: | CCOc1ccc(cc1)n1c(C)c(C)c2c1ncn1c2nc(c2ccccc2[Cl])n1 |
| Stereo: | ACHIRAL |
| logP: | 5.0555 |
| logD: | 4.929 |
| logSw: | -5.1167 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 39.941 |
| InChI Key: | SLUWRIOSZWAOOU-UHFFFAOYSA-N |