5-chloro-N-[2-(4-fluoro-3-methylbenzene-1-sulfonyl)-2-(pyridin-3-yl)ethyl]thiophene-2-sulfonamide
Chemical Structure Depiction of
5-chloro-N-[2-(4-fluoro-3-methylbenzene-1-sulfonyl)-2-(pyridin-3-yl)ethyl]thiophene-2-sulfonamide
5-chloro-N-[2-(4-fluoro-3-methylbenzene-1-sulfonyl)-2-(pyridin-3-yl)ethyl]thiophene-2-sulfonamide
Compound characteristics
| Compound ID: | D473-0579 |
| Compound Name: | 5-chloro-N-[2-(4-fluoro-3-methylbenzene-1-sulfonyl)-2-(pyridin-3-yl)ethyl]thiophene-2-sulfonamide |
| Molecular Weight: | 474.98 |
| Molecular Formula: | C18 H16 Cl F N2 O4 S3 |
| Smiles: | Cc1cc(ccc1F)S(C(CNS(c1ccc(s1)[Cl])(=O)=O)c1cccnc1)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.5152 |
| logD: | 3.5107 |
| logSw: | -3.8684 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 82.034 |
| InChI Key: | OOSCZDNUXDJCEG-INIZCTEOSA-N |