2-{4-[(4-chlorophenyl)methyl]-5-hydroxy-3-methyl-1H-pyrazol-1-yl}-N-(2,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-5-carboxamide
Chemical Structure Depiction of
2-{4-[(4-chlorophenyl)methyl]-5-hydroxy-3-methyl-1H-pyrazol-1-yl}-N-(2,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-5-carboxamide
2-{4-[(4-chlorophenyl)methyl]-5-hydroxy-3-methyl-1H-pyrazol-1-yl}-N-(2,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-5-carboxamide
Compound characteristics
| Compound ID: | D475-2128 |
| Compound Name: | 2-{4-[(4-chlorophenyl)methyl]-5-hydroxy-3-methyl-1H-pyrazol-1-yl}-N-(2,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-5-carboxamide |
| Molecular Weight: | 498.99 |
| Molecular Formula: | C24 H23 Cl N4 O4 S |
| Smiles: | [H]C([H])(c1ccc(cc1)[Cl])c1c(C)nn(c1O)c1nc(C)c(C(Nc2ccc(cc2OC)OC)=O)s1 |
| Stereo: | ACHIRAL |
| logP: | 4.7627 |
| logD: | 3.353 |
| logSw: | -4.6859 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 77.782 |
| InChI Key: | HCHMVMYTEAKCMJ-UHFFFAOYSA-N |