2-[2-(4-benzyl-3,5-dimethyl-1H-pyrazol-1-yl)-1,3-thiazol-4-yl]-N-(4-phenyl-1,3-thiazol-2-yl)acetamide
Chemical Structure Depiction of
2-[2-(4-benzyl-3,5-dimethyl-1H-pyrazol-1-yl)-1,3-thiazol-4-yl]-N-(4-phenyl-1,3-thiazol-2-yl)acetamide
2-[2-(4-benzyl-3,5-dimethyl-1H-pyrazol-1-yl)-1,3-thiazol-4-yl]-N-(4-phenyl-1,3-thiazol-2-yl)acetamide
Compound characteristics
| Compound ID: | D481-1727 |
| Compound Name: | 2-[2-(4-benzyl-3,5-dimethyl-1H-pyrazol-1-yl)-1,3-thiazol-4-yl]-N-(4-phenyl-1,3-thiazol-2-yl)acetamide |
| Molecular Weight: | 485.63 |
| Molecular Formula: | C26 H23 N5 O S2 |
| Smiles: | [H]C([H])(c1ccccc1)c1c(C)nn(c1C)c1nc(CC(Nc2nc(cs2)c2ccccc2)=O)cs1 |
| Stereo: | ACHIRAL |
| logP: | 6.3517 |
| logD: | 6.3514 |
| logSw: | -5.6431 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.353 |
| InChI Key: | YNCCXMVBOYUJBO-UHFFFAOYSA-N |