1-[5-amino-3-(4-methylphenyl)-1H-1,2,4-triazol-1-yl]-2,2-dimethylpropan-1-one
Chemical Structure Depiction of
1-[5-amino-3-(4-methylphenyl)-1H-1,2,4-triazol-1-yl]-2,2-dimethylpropan-1-one
1-[5-amino-3-(4-methylphenyl)-1H-1,2,4-triazol-1-yl]-2,2-dimethylpropan-1-one
Compound characteristics
| Compound ID: | D481-1827 |
| Compound Name: | 1-[5-amino-3-(4-methylphenyl)-1H-1,2,4-triazol-1-yl]-2,2-dimethylpropan-1-one |
| Molecular Weight: | 258.32 |
| Molecular Formula: | C14 H18 N4 O |
| Smiles: | Cc1ccc(cc1)c1nc(N)n(C(C(C)(C)C)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 2.8381 |
| logD: | 2.8381 |
| logSw: | -3.0894 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 58.118 |
| InChI Key: | MMTVHFFCAAZELD-UHFFFAOYSA-N |