[5-amino-3-(3-methylphenyl)-1H-1,2,4-triazol-1-yl](4-methoxyphenyl)methanone
Chemical Structure Depiction of
[5-amino-3-(3-methylphenyl)-1H-1,2,4-triazol-1-yl](4-methoxyphenyl)methanone
[5-amino-3-(3-methylphenyl)-1H-1,2,4-triazol-1-yl](4-methoxyphenyl)methanone
Compound characteristics
| Compound ID: | D481-1898 |
| Compound Name: | [5-amino-3-(3-methylphenyl)-1H-1,2,4-triazol-1-yl](4-methoxyphenyl)methanone |
| Molecular Weight: | 308.34 |
| Molecular Formula: | C17 H16 N4 O2 |
| Smiles: | Cc1cccc(c1)c1nc(N)n(C(c2ccc(cc2)OC)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 2.9592 |
| logD: | 2.9592 |
| logSw: | -3.2008 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 65.391 |
| InChI Key: | YVECOSFBYDVHSN-UHFFFAOYSA-N |