N-[4-(4-methoxyphenyl)-6-(4-methylphenyl)pyrimidin-2-yl]-N~2~-(3-methylphenyl)glycinamide
Chemical Structure Depiction of
N-[4-(4-methoxyphenyl)-6-(4-methylphenyl)pyrimidin-2-yl]-N~2~-(3-methylphenyl)glycinamide
N-[4-(4-methoxyphenyl)-6-(4-methylphenyl)pyrimidin-2-yl]-N~2~-(3-methylphenyl)glycinamide
Compound characteristics
| Compound ID: | D481-2543 |
| Compound Name: | N-[4-(4-methoxyphenyl)-6-(4-methylphenyl)pyrimidin-2-yl]-N~2~-(3-methylphenyl)glycinamide |
| Molecular Weight: | 438.53 |
| Molecular Formula: | C27 H26 N4 O2 |
| Smiles: | Cc1ccc(cc1)c1cc(c2ccc(cc2)OC)nc(NC(CNc2cccc(C)c2)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 6.8649 |
| logD: | 6.8648 |
| logSw: | -5.5932 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 60.328 |
| InChI Key: | ZXZWOYYBGFZNIU-UHFFFAOYSA-N |