1-[6-(4-methylphenyl)-2-{[(4-methylphenyl)methyl]sulfanyl}pyrimidin-4-yl]piperidine-4-carboxamide
Chemical Structure Depiction of
1-[6-(4-methylphenyl)-2-{[(4-methylphenyl)methyl]sulfanyl}pyrimidin-4-yl]piperidine-4-carboxamide
1-[6-(4-methylphenyl)-2-{[(4-methylphenyl)methyl]sulfanyl}pyrimidin-4-yl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | D482-2763 |
| Compound Name: | 1-[6-(4-methylphenyl)-2-{[(4-methylphenyl)methyl]sulfanyl}pyrimidin-4-yl]piperidine-4-carboxamide |
| Molecular Weight: | 432.59 |
| Molecular Formula: | C25 H28 N4 O S |
| Smiles: | Cc1ccc(CSc2nc(cc(n2)N2CCC(CC2)C(N)=O)c2ccc(C)cc2)cc1 |
| Stereo: | ACHIRAL |
| logP: | 5.6143 |
| logD: | 5.6128 |
| logSw: | -5.3318 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 53.963 |
| InChI Key: | MBPGCJUSQHDDRL-UHFFFAOYSA-N |