N-{2-[phenyl(piperidin-1-yl)methyl]-1-benzofuran-3-yl}benzamide
Chemical Structure Depiction of
N-{2-[phenyl(piperidin-1-yl)methyl]-1-benzofuran-3-yl}benzamide
N-{2-[phenyl(piperidin-1-yl)methyl]-1-benzofuran-3-yl}benzamide
Compound characteristics
| Compound ID: | D485-0781 |
| Compound Name: | N-{2-[phenyl(piperidin-1-yl)methyl]-1-benzofuran-3-yl}benzamide |
| Molecular Weight: | 410.52 |
| Molecular Formula: | C27 H26 N2 O2 |
| Smiles: | C1CCN(CC1)C(c1ccccc1)c1c(c2ccccc2o1)NC(c1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.3167 |
| logD: | 5.0938 |
| logSw: | -5.8684 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 33.213 |
| InChI Key: | MYXJYRXFELOYIL-RUZDIDTESA-N |