2-{[5-(4-methylphenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]sulfanyl}-N-(5-methyl-1,3-thiazol-2-yl)acetamide
Chemical Structure Depiction of
2-{[5-(4-methylphenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]sulfanyl}-N-(5-methyl-1,3-thiazol-2-yl)acetamide
2-{[5-(4-methylphenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]sulfanyl}-N-(5-methyl-1,3-thiazol-2-yl)acetamide
Compound characteristics
| Compound ID: | D489-0984 |
| Compound Name: | 2-{[5-(4-methylphenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]sulfanyl}-N-(5-methyl-1,3-thiazol-2-yl)acetamide |
| Molecular Weight: | 421.54 |
| Molecular Formula: | C21 H19 N5 O S2 |
| Smiles: | Cc1ccc(cc1)c1nnc(n1c1ccccc1)SCC(Nc1ncc(C)s1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1791 |
| logD: | 5.1741 |
| logSw: | -4.8812 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.43 |
| InChI Key: | MPKHJCHBCCJCQU-UHFFFAOYSA-N |