3-chloro-N-[2-(diethylamino)-2-phenylethyl]-6-methyl-1-benzothiophene-2-carboxamide
Chemical Structure Depiction of
3-chloro-N-[2-(diethylamino)-2-phenylethyl]-6-methyl-1-benzothiophene-2-carboxamide
3-chloro-N-[2-(diethylamino)-2-phenylethyl]-6-methyl-1-benzothiophene-2-carboxamide
Compound characteristics
| Compound ID: | D491-1195 |
| Compound Name: | 3-chloro-N-[2-(diethylamino)-2-phenylethyl]-6-methyl-1-benzothiophene-2-carboxamide |
| Molecular Weight: | 400.97 |
| Molecular Formula: | C22 H25 Cl N2 O S |
| Smiles: | [H]N(CC(c1ccccc1)N(CC)CC)C(c1c(c2ccc(C)cc2s1)[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.534 |
| logD: | 5.0809 |
| logSw: | -5.9754 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 27.6717 |
| InChI Key: | PSTUQAHKISYVJY-SFHVURJKSA-N |