N-[2-(4-tert-butylphenyl)-2-(pyrrolidin-1-yl)ethyl]-3,5-dimethyl-1-benzofuran-2-carboxamide
Chemical Structure Depiction of
N-[2-(4-tert-butylphenyl)-2-(pyrrolidin-1-yl)ethyl]-3,5-dimethyl-1-benzofuran-2-carboxamide
N-[2-(4-tert-butylphenyl)-2-(pyrrolidin-1-yl)ethyl]-3,5-dimethyl-1-benzofuran-2-carboxamide
Compound characteristics
| Compound ID: | D491-2040 |
| Compound Name: | N-[2-(4-tert-butylphenyl)-2-(pyrrolidin-1-yl)ethyl]-3,5-dimethyl-1-benzofuran-2-carboxamide |
| Molecular Weight: | 418.58 |
| Molecular Formula: | C27 H34 N2 O2 |
| Smiles: | [H]N(CC(c1ccc(cc1)C(C)(C)C)N1CCCC1)C(c1c(C)c2cc(C)ccc2o1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.3349 |
| logD: | 5.1784 |
| logSw: | -5.5045 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 36.533 |
| InChI Key: | UPRDQEMOAUEHOF-QHCPKHFHSA-N |