N-[2-(furan-2-yl)-2-(morpholin-4-yl)ethyl]-6,8-dimethyl-4-oxo-4H-1-benzopyran-2-carboxamide
Chemical Structure Depiction of
N-[2-(furan-2-yl)-2-(morpholin-4-yl)ethyl]-6,8-dimethyl-4-oxo-4H-1-benzopyran-2-carboxamide
N-[2-(furan-2-yl)-2-(morpholin-4-yl)ethyl]-6,8-dimethyl-4-oxo-4H-1-benzopyran-2-carboxamide
Compound characteristics
| Compound ID: | D491-2594 |
| Compound Name: | N-[2-(furan-2-yl)-2-(morpholin-4-yl)ethyl]-6,8-dimethyl-4-oxo-4H-1-benzopyran-2-carboxamide |
| Molecular Weight: | 396.44 |
| Molecular Formula: | C22 H24 N2 O5 |
| Smiles: | [H]N(CC(c1ccco1)N1CCOCC1)C(C1=CC(c2cc(C)cc(C)c2O1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.6798 |
| logD: | 2.6787 |
| logSw: | -3.1186 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.631 |
| InChI Key: | WQJSEYRUJMURBN-KRWDZBQOSA-N |