6-chloro-N-[2-(dimethylamino)-2-(thiophen-2-yl)ethyl]-7-methyl-4-oxo-4H-1-benzopyran-2-carboxamide
Chemical Structure Depiction of
6-chloro-N-[2-(dimethylamino)-2-(thiophen-2-yl)ethyl]-7-methyl-4-oxo-4H-1-benzopyran-2-carboxamide
6-chloro-N-[2-(dimethylamino)-2-(thiophen-2-yl)ethyl]-7-methyl-4-oxo-4H-1-benzopyran-2-carboxamide
Compound characteristics
| Compound ID: | D491-2882 |
| Compound Name: | 6-chloro-N-[2-(dimethylamino)-2-(thiophen-2-yl)ethyl]-7-methyl-4-oxo-4H-1-benzopyran-2-carboxamide |
| Molecular Weight: | 390.89 |
| Molecular Formula: | C19 H19 Cl N2 O3 S |
| Smiles: | [H]N(CC(c1cccs1)N(C)C)C(C1=CC(c2cc(c(C)cc2O1)[Cl])=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.044 |
| logD: | 3.7483 |
| logSw: | -4.498 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.83 |
| InChI Key: | CHINQASPCHWXLK-AWEZNQCLSA-N |