2-[3-(dimethylamino)propyl]-1-(4-ethylphenyl)-7-methyl-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
Chemical Structure Depiction of
2-[3-(dimethylamino)propyl]-1-(4-ethylphenyl)-7-methyl-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
2-[3-(dimethylamino)propyl]-1-(4-ethylphenyl)-7-methyl-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
Compound characteristics
| Compound ID: | D491-3402 |
| Compound Name: | 2-[3-(dimethylamino)propyl]-1-(4-ethylphenyl)-7-methyl-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione |
| Molecular Weight: | 404.51 |
| Molecular Formula: | C25 H28 N2 O3 |
| Smiles: | CCc1ccc(cc1)C1C2=C(C(N1CCCN(C)C)=O)Oc1ccc(C)cc1C2=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.1413 |
| logD: | 2.1926 |
| logSw: | -4.1512 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 40.849 |
| InChI Key: | WAUVXIYCHOZRSF-JOCHJYFZSA-N |