N-[3-(5-bromofuran-2-yl)-1,2,4-thiadiazol-5-yl]-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
N-[3-(5-bromofuran-2-yl)-1,2,4-thiadiazol-5-yl]-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,2-oxazole-3-carboxamide
N-[3-(5-bromofuran-2-yl)-1,2,4-thiadiazol-5-yl]-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | D491-4657 |
| Compound Name: | N-[3-(5-bromofuran-2-yl)-1,2,4-thiadiazol-5-yl]-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 471.33 |
| Molecular Formula: | C20 H15 Br N4 O3 S |
| Smiles: | [H]N(C(c1cc(c2ccc3CCCCc3c2)on1)=O)c1nc(c2ccc(o2)[Br])ns1 |
| Stereo: | ACHIRAL |
| logP: | 5.9714 |
| logD: | 5.9711 |
| logSw: | -5.9769 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 74.299 |
| InChI Key: | ATMSSTJLDHVZEI-UHFFFAOYSA-N |