N-[2-(dimethylamino)-2-(5-methylfuran-2-yl)ethyl]thiophene-2-carboxamide--hydrogen chloride (1/1)
Chemical Structure Depiction of
N-[2-(dimethylamino)-2-(5-methylfuran-2-yl)ethyl]thiophene-2-carboxamide--hydrogen chloride (1/1)
N-[2-(dimethylamino)-2-(5-methylfuran-2-yl)ethyl]thiophene-2-carboxamide--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | D491-7311 |
| Compound Name: | N-[2-(dimethylamino)-2-(5-methylfuran-2-yl)ethyl]thiophene-2-carboxamide--hydrogen chloride (1/1) |
| Molecular Weight: | 314.83 |
| Molecular Formula: | C14 H18 N2 O2 S |
| Salt: | HCl |
| Smiles: | [H]N(CC(c1ccc(C)o1)N(C)C)C(c1cccs1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.1154 |
| logD: | 1.5141 |
| logSw: | -2.6183 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 36.104 |
| InChI Key: | WXIWDFLIQPJALI-NSHDSACASA-N |