2-(4-chlorophenoxy)-N-[2-(5-methylfuran-2-yl)-2-(piperidin-1-yl)ethyl]acetamide--hydrogen chloride (1/1)
Chemical Structure Depiction of
2-(4-chlorophenoxy)-N-[2-(5-methylfuran-2-yl)-2-(piperidin-1-yl)ethyl]acetamide--hydrogen chloride (1/1)
2-(4-chlorophenoxy)-N-[2-(5-methylfuran-2-yl)-2-(piperidin-1-yl)ethyl]acetamide--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | D491-7362 |
| Compound Name: | 2-(4-chlorophenoxy)-N-[2-(5-methylfuran-2-yl)-2-(piperidin-1-yl)ethyl]acetamide--hydrogen chloride (1/1) |
| Molecular Weight: | 413.34 |
| Molecular Formula: | C20 H25 Cl N2 O3 |
| Salt: | HCl |
| Smiles: | [H]N(CC(c1ccc(C)o1)N1CCCCC1)C(COc1ccc(cc1)[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.5441 |
| logD: | 2.3721 |
| logSw: | -3.7994 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.019 |
| InChI Key: | CWGNWOZSGDPXNH-SFHVURJKSA-N |