N-[2-(dimethylamino)-2-(5-methylfuran-2-yl)ethyl]-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,2-oxazole-3-carboxamide--hydrogen chloride (1/1)
Chemical Structure Depiction of
N-[2-(dimethylamino)-2-(5-methylfuran-2-yl)ethyl]-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,2-oxazole-3-carboxamide--hydrogen chloride (1/1)
N-[2-(dimethylamino)-2-(5-methylfuran-2-yl)ethyl]-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,2-oxazole-3-carboxamide--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | D491-8113 |
| Compound Name: | N-[2-(dimethylamino)-2-(5-methylfuran-2-yl)ethyl]-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,2-oxazole-3-carboxamide--hydrogen chloride (1/1) |
| Molecular Weight: | 429.95 |
| Molecular Formula: | C23 H27 N3 O3 |
| Salt: | HCl |
| Smiles: | [H]N(CC(c1ccc(C)o1)N(C)C)C(c1cc(c2ccc3CCCCc3c2)on1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.4469 |
| logD: | 3.8272 |
| logSw: | -4.3391 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.542 |
| InChI Key: | FRGAMVLQMYDGRS-FQEVSTJZSA-N |