N-({4-[(4-fluorophenyl)methoxy]phenyl}methyl)-N-(pyridin-2-yl)propanamide
Chemical Structure Depiction of
N-({4-[(4-fluorophenyl)methoxy]phenyl}methyl)-N-(pyridin-2-yl)propanamide
N-({4-[(4-fluorophenyl)methoxy]phenyl}methyl)-N-(pyridin-2-yl)propanamide
Compound characteristics
| Compound ID: | D491-8972 |
| Compound Name: | N-({4-[(4-fluorophenyl)methoxy]phenyl}methyl)-N-(pyridin-2-yl)propanamide |
| Molecular Weight: | 364.42 |
| Molecular Formula: | C22 H21 F N2 O2 |
| Smiles: | CCC(N(Cc1ccc(cc1)OCc1ccc(cc1)F)c1ccccn1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6378 |
| logD: | 4.6378 |
| logSw: | -4.5389 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 31.0725 |
| InChI Key: | UZHSWPKQBOEFRJ-UHFFFAOYSA-N |