N-({4-[(4-chlorophenyl)methoxy]phenyl}methyl)-N-(pyridin-2-yl)furan-2-carboxamide
Chemical Structure Depiction of
N-({4-[(4-chlorophenyl)methoxy]phenyl}methyl)-N-(pyridin-2-yl)furan-2-carboxamide
N-({4-[(4-chlorophenyl)methoxy]phenyl}methyl)-N-(pyridin-2-yl)furan-2-carboxamide
Compound characteristics
| Compound ID: | D491-8999 |
| Compound Name: | N-({4-[(4-chlorophenyl)methoxy]phenyl}methyl)-N-(pyridin-2-yl)furan-2-carboxamide |
| Molecular Weight: | 418.88 |
| Molecular Formula: | C24 H19 Cl N2 O3 |
| Smiles: | C(c1ccc(cc1)OCc1ccc(cc1)[Cl])N(C(c1ccco1)=O)c1ccccn1 |
| Stereo: | ACHIRAL |
| logP: | 5.377 |
| logD: | 5.377 |
| logSw: | -5.9758 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 39.907 |
| InChI Key: | JTSXGMZBFGIUPG-UHFFFAOYSA-N |