N-{[4-(dimethylamino)phenyl]methyl}-2-(3,4-dimethylphenoxy)-N-(pyridin-2-yl)acetamide
Chemical Structure Depiction of
N-{[4-(dimethylamino)phenyl]methyl}-2-(3,4-dimethylphenoxy)-N-(pyridin-2-yl)acetamide
N-{[4-(dimethylamino)phenyl]methyl}-2-(3,4-dimethylphenoxy)-N-(pyridin-2-yl)acetamide
Compound characteristics
| Compound ID: | D491-9149 |
| Compound Name: | N-{[4-(dimethylamino)phenyl]methyl}-2-(3,4-dimethylphenoxy)-N-(pyridin-2-yl)acetamide |
| Molecular Weight: | 389.5 |
| Molecular Formula: | C24 H27 N3 O2 |
| Smiles: | Cc1ccc(cc1C)OCC(N(Cc1ccc(cc1)N(C)C)c1ccccn1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.0967 |
| logD: | 5.0813 |
| logSw: | -4.8694 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 33.877 |
| InChI Key: | APPLYISIDPXRID-UHFFFAOYSA-N |