3,5-dimethyl-N-{1-[(thiophen-2-yl)methyl]-1H-pyrazol-5-yl}-1-benzofuran-2-carboxamide
Chemical Structure Depiction of
3,5-dimethyl-N-{1-[(thiophen-2-yl)methyl]-1H-pyrazol-5-yl}-1-benzofuran-2-carboxamide
3,5-dimethyl-N-{1-[(thiophen-2-yl)methyl]-1H-pyrazol-5-yl}-1-benzofuran-2-carboxamide
Compound characteristics
| Compound ID: | D492-0051 |
| Compound Name: | 3,5-dimethyl-N-{1-[(thiophen-2-yl)methyl]-1H-pyrazol-5-yl}-1-benzofuran-2-carboxamide |
| Molecular Weight: | 351.43 |
| Molecular Formula: | C19 H17 N3 O2 S |
| Smiles: | [H]N(C(c1c(C)c2cc(C)ccc2o1)=O)c1ccnn1Cc1cccs1 |
| Stereo: | ACHIRAL |
| logP: | 4.4121 |
| logD: | 4.4115 |
| logSw: | -4.2319 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.307 |
| InChI Key: | VIVGPUXLPKGGLH-UHFFFAOYSA-N |