N-[(2-chlorophenyl)methyl]-2-methyl-5-(3-methyl-4-oxo-3,4,5,6,7,8-hexahydrophthalazin-1-yl)benzene-1-sulfonamide
Chemical Structure Depiction of
N-[(2-chlorophenyl)methyl]-2-methyl-5-(3-methyl-4-oxo-3,4,5,6,7,8-hexahydrophthalazin-1-yl)benzene-1-sulfonamide
N-[(2-chlorophenyl)methyl]-2-methyl-5-(3-methyl-4-oxo-3,4,5,6,7,8-hexahydrophthalazin-1-yl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | D505-0029 |
| Compound Name: | N-[(2-chlorophenyl)methyl]-2-methyl-5-(3-methyl-4-oxo-3,4,5,6,7,8-hexahydrophthalazin-1-yl)benzene-1-sulfonamide |
| Molecular Weight: | 457.98 |
| Molecular Formula: | C23 H24 Cl N3 O3 S |
| Smiles: | Cc1ccc(cc1S(NCc1ccccc1[Cl])(=O)=O)C1C2CCCCC=2C(N(C)N=1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1711 |
| logD: | 5.1682 |
| logSw: | -5.6087 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.096 |
| InChI Key: | WKRCBRBWIOOOGH-UHFFFAOYSA-N |