N-(2-ethylphenyl)-2-methyl-5-(3-methyl-4-oxo-3,4,5,6,7,8-hexahydrophthalazin-1-yl)benzene-1-sulfonamide
Chemical Structure Depiction of
N-(2-ethylphenyl)-2-methyl-5-(3-methyl-4-oxo-3,4,5,6,7,8-hexahydrophthalazin-1-yl)benzene-1-sulfonamide
N-(2-ethylphenyl)-2-methyl-5-(3-methyl-4-oxo-3,4,5,6,7,8-hexahydrophthalazin-1-yl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | D505-0078 |
| Compound Name: | N-(2-ethylphenyl)-2-methyl-5-(3-methyl-4-oxo-3,4,5,6,7,8-hexahydrophthalazin-1-yl)benzene-1-sulfonamide |
| Molecular Weight: | 437.56 |
| Molecular Formula: | C24 H27 N3 O3 S |
| Smiles: | CCc1ccccc1NS(c1cc(ccc1C)C1C2CCCCC=2C(N(C)N=1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1844 |
| logD: | 5.1346 |
| logSw: | -4.8456 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.29 |
| InChI Key: | FOZKTYRKBHVKML-UHFFFAOYSA-N |