4-fluoro-N-[(3-fluorophenyl)methyl]-N-(pyridin-2-yl)benzamide
Chemical Structure Depiction of
4-fluoro-N-[(3-fluorophenyl)methyl]-N-(pyridin-2-yl)benzamide
4-fluoro-N-[(3-fluorophenyl)methyl]-N-(pyridin-2-yl)benzamide
Compound characteristics
| Compound ID: | D508-0013 |
| Compound Name: | 4-fluoro-N-[(3-fluorophenyl)methyl]-N-(pyridin-2-yl)benzamide |
| Molecular Weight: | 324.33 |
| Molecular Formula: | C19 H14 F2 N2 O |
| Smiles: | C(c1cccc(c1)F)N(C(c1ccc(cc1)F)=O)c1ccccn1 |
| Stereo: | ACHIRAL |
| logP: | 4.2425 |
| logD: | 4.2425 |
| logSw: | -4.5169 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 24.1008 |
| InChI Key: | MQCUYWUVIJIDPF-UHFFFAOYSA-N |