4-ethoxy-N-[(3-fluorophenyl)methyl]-N-(pyridin-2-yl)benzamide
Chemical Structure Depiction of
4-ethoxy-N-[(3-fluorophenyl)methyl]-N-(pyridin-2-yl)benzamide
4-ethoxy-N-[(3-fluorophenyl)methyl]-N-(pyridin-2-yl)benzamide
Compound characteristics
| Compound ID: | D508-0026 |
| Compound Name: | 4-ethoxy-N-[(3-fluorophenyl)methyl]-N-(pyridin-2-yl)benzamide |
| Molecular Weight: | 350.39 |
| Molecular Formula: | C21 H19 F N2 O2 |
| Smiles: | CCOc1ccc(cc1)C(N(Cc1cccc(c1)F)c1ccccn1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5824 |
| logD: | 4.5824 |
| logSw: | -4.3189 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 31.2244 |
| InChI Key: | SLBZFDLLDWRPQF-UHFFFAOYSA-N |