4-chloro-N-[(2-chloro-4-fluorophenyl)methyl]-N-(pyridin-2-yl)benzamide
Chemical Structure Depiction of
4-chloro-N-[(2-chloro-4-fluorophenyl)methyl]-N-(pyridin-2-yl)benzamide
4-chloro-N-[(2-chloro-4-fluorophenyl)methyl]-N-(pyridin-2-yl)benzamide
Compound characteristics
| Compound ID: | D508-0099 |
| Compound Name: | 4-chloro-N-[(2-chloro-4-fluorophenyl)methyl]-N-(pyridin-2-yl)benzamide |
| Molecular Weight: | 375.23 |
| Molecular Formula: | C19 H13 Cl2 F N2 O |
| Smiles: | C(c1ccc(cc1[Cl])F)N(C(c1ccc(cc1)[Cl])=O)c1ccccn1 |
| Stereo: | ACHIRAL |
| logP: | 5.4108 |
| logD: | 5.4108 |
| logSw: | -5.9918 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 24.1008 |
| InChI Key: | JSIBLFIPFZFRTE-UHFFFAOYSA-N |