4-chloro-N-[(2-chloro-6-fluorophenyl)methyl]-N-(5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)benzene-1-sulfonamide
Chemical Structure Depiction of
4-chloro-N-[(2-chloro-6-fluorophenyl)methyl]-N-(5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)benzene-1-sulfonamide
4-chloro-N-[(2-chloro-6-fluorophenyl)methyl]-N-(5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | D513-3588 |
| Compound Name: | 4-chloro-N-[(2-chloro-6-fluorophenyl)methyl]-N-(5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)benzene-1-sulfonamide |
| Molecular Weight: | 480.35 |
| Molecular Formula: | C20 H16 Cl2 F N5 O2 S |
| Smiles: | Cc1cc(C)n2c(n1)nc(n2)N(Cc1c(cccc1[Cl])F)S(c1ccc(cc1)[Cl])(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4348 |
| logD: | 4.4348 |
| logSw: | -4.5078 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 61.31 |
| InChI Key: | UEGDHLNDQRYXME-UHFFFAOYSA-N |