4-chloro-N-(6-chloro-5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-N-(2-phenoxyethyl)benzene-1-sulfonamide
Chemical Structure Depiction of
4-chloro-N-(6-chloro-5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-N-(2-phenoxyethyl)benzene-1-sulfonamide
4-chloro-N-(6-chloro-5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-N-(2-phenoxyethyl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | D513-3696 |
| Compound Name: | 4-chloro-N-(6-chloro-5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-N-(2-phenoxyethyl)benzene-1-sulfonamide |
| Molecular Weight: | 492.38 |
| Molecular Formula: | C21 H19 Cl2 N5 O3 S |
| Smiles: | Cc1c(c(C)n2c(n1)nc(n2)N(CCOc1ccccc1)S(c1ccc(cc1)[Cl])(=O)=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.7956 |
| logD: | 4.7956 |
| logSw: | -4.9282 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 69.253 |
| InChI Key: | VTGHKYIJLZVBJG-UHFFFAOYSA-N |