N-{2-[5-(3,4-dimethoxybenzamido)-1-methyl-1H-benzimidazol-2-yl]ethyl}thiophene-2-carboxamide
Chemical Structure Depiction of
N-{2-[5-(3,4-dimethoxybenzamido)-1-methyl-1H-benzimidazol-2-yl]ethyl}thiophene-2-carboxamide
N-{2-[5-(3,4-dimethoxybenzamido)-1-methyl-1H-benzimidazol-2-yl]ethyl}thiophene-2-carboxamide
Compound characteristics
| Compound ID: | D516-0096 |
| Compound Name: | N-{2-[5-(3,4-dimethoxybenzamido)-1-methyl-1H-benzimidazol-2-yl]ethyl}thiophene-2-carboxamide |
| Molecular Weight: | 464.54 |
| Molecular Formula: | C24 H24 N4 O4 S |
| Smiles: | Cn1c2ccc(cc2nc1CCNC(c1cccs1)=O)NC(c1ccc(c(c1)OC)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 2.8782 |
| logD: | 2.878 |
| logSw: | -3.5219 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 75.85 |
| InChI Key: | UDVRGQSZZLZHMC-UHFFFAOYSA-N |