2-methoxy-N-{2-[1-methyl-5-(2-methylbenzamido)-1H-benzimidazol-2-yl]ethyl}benzamide
Chemical Structure Depiction of
2-methoxy-N-{2-[1-methyl-5-(2-methylbenzamido)-1H-benzimidazol-2-yl]ethyl}benzamide
2-methoxy-N-{2-[1-methyl-5-(2-methylbenzamido)-1H-benzimidazol-2-yl]ethyl}benzamide
Compound characteristics
| Compound ID: | D516-0229 |
| Compound Name: | 2-methoxy-N-{2-[1-methyl-5-(2-methylbenzamido)-1H-benzimidazol-2-yl]ethyl}benzamide |
| Molecular Weight: | 442.52 |
| Molecular Formula: | C26 H26 N4 O3 |
| Smiles: | Cc1ccccc1C(Nc1ccc2c(c1)nc(CCNC(c1ccccc1OC)=O)n2C)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7608 |
| logD: | 3.7602 |
| logSw: | -4.0515 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 67.201 |
| InChI Key: | FQHDNZJBYORCHE-UHFFFAOYSA-N |