N-(3,5-dimethoxyphenyl)-1-methyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide
Chemical Structure Depiction of
N-(3,5-dimethoxyphenyl)-1-methyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide
N-(3,5-dimethoxyphenyl)-1-methyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide
Compound characteristics
| Compound ID: | D522-0038 |
| Compound Name: | N-(3,5-dimethoxyphenyl)-1-methyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide |
| Molecular Weight: | 329.28 |
| Molecular Formula: | C14 H14 F3 N3 O3 |
| Smiles: | [H]c1c(C(Nc2cc(cc(c2)OC)OC)=O)nn(C)c1C(F)(F)F |
| Stereo: | ACHIRAL |
| logP: | 2.5751 |
| logD: | 2.5744 |
| logSw: | -2.8916 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.933 |
| InChI Key: | MKXNBVUJYFQQHK-UHFFFAOYSA-N |